C15H27NO — CID 162991752
1-cyclohexyl-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-5-amine (PubChem CID 162991752) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-5-amine.
| Compound Name | 1-cyclohexyl-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-5-amine |
|---|---|
| PubChem CID | 162991752 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-cyclohexyl-3,3-dimethyl-2-oxabicyclo[2.2.2]octan-5-amine |
| SMILES | CC1(C)OC2(C3CCCCC3)CCC1C(N)C2 |
| InChI | InChI=1S/C15H27NO/c1-14(2)12-8-9-15(17-14,10-13(12)16)11-6-4-3-5-7-11/h11-13H,3-10,16H2,1-2H3 |
| InChIKey | CVIUKNANURGHTD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |