C8H12O2 — CID 123940865
6a-ethenyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 123940865) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 6a-ethenyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | 6a-ethenyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 123940865 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 6a-ethenyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | C=CC12CCOC1CCO2 |
| InChI | InChI=1S/C8H12O2/c1-2-8-4-6-9-7(8)3-5-10-8/h2,7H,1,3-6H2 |
| InChIKey | JYGJEVAZEICJBO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|