C17H20O7 — CID 135024111
(1R,2S,3R,6S,8R,9R)-2,3-dihydroxy-8-(4-methoxyphenyl)-7,12,13-trioxatricyclo[7.3.1.01,6]tridecan-4-one (PubChem CID 135024111) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (1R,2S,3R,6S,8R,9R)-2,3-dihydroxy-8-(4-methoxyphenyl)-7,12,13-trioxatricyclo[7.3.1.01,6]tridecan-4-one.
| Compound Name | (1R,2S,3R,6S,8R,9R)-2,3-dihydroxy-8-(4-methoxyphenyl)-7,12,13-trioxatricyclo[7.3.1.01,6]tridecan-4-one |
|---|---|
| PubChem CID | 135024111 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (1R,2S,3R,6S,8R,9R)-2,3-dihydroxy-8-(4-methoxyphenyl)-7,12,13-trioxatricyclo[7.3.1.01,6]tridecan-4-one |
| SMILES | COc1ccc([C@H]2O[C@H]3CC(=O)[C@H](O)[C@H](O)[C@]34OCC[C@H]2O4)cc1 |
| InChI | InChI=1S/C17H20O7/c1-21-10-4-2-9(3-5-10)15-12-6-7-22-17(24-12)13(23-15)8-11(18)14(19)16(17)20/h2-5,12-16,19-20H,6-8H2,1H3/t12-,13+,14+,15-,16+,17+/m1/s1 |
| InChIKey | JAKWLFXHDYVPAG-GGUVTUNTSA-N |
| XLogP | 0.33 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |