C9H12O4 — CID 101449077
(1aS,3aR,7aS,7bR)-7a-hydroxy-3,3a,5,6,7,7b-hexahydro-1aH-oxireno[2,3-f]chromen-2-one (PubChem CID 101449077) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (1aS,3aR,7aS,7bR)-7a-hydroxy-3,3a,5,6,7,7b-hexahydro-1aH-oxireno[2,3-f]chromen-2-one.
| Compound Name | (1aS,3aR,7aS,7bR)-7a-hydroxy-3,3a,5,6,7,7b-hexahydro-1aH-oxireno[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 101449077 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1aS,3aR,7aS,7bR)-7a-hydroxy-3,3a,5,6,7,7b-hexahydro-1aH-oxireno[2,3-f]chromen-2-one |
| SMILES | O=C1C[C@H]2OCCC[C@@]2(O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C9H12O4/c10-5-4-6-9(11,2-1-3-12-6)8-7(5)13-8/h6-8,11H,1-4H2/t6-,7-,8-,9+/m1/s1 |
| InChIKey | JKKAHGVIJCEWCJ-BGZDPUMWSA-N |
| XLogP | -0.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|