C8H10O4 — CID 23730757
(1aS,3aR,6aS,6bR)-6a-hydroxy-1a,3,3a,5,6,6b-hexahydrooxireno[2,3-e][1]benzofuran-2-one (PubChem CID 23730757) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (1aS,3aR,6aS,6bR)-6a-hydroxy-1a,3,3a,5,6,6b-hexahydrooxireno[2,3-e][1]benzofuran-2-one.
| Compound Name | (1aS,3aR,6aS,6bR)-6a-hydroxy-1a,3,3a,5,6,6b-hexahydrooxireno[2,3-e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 23730757 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1aS,3aR,6aS,6bR)-6a-hydroxy-1a,3,3a,5,6,6b-hexahydrooxireno[2,3-e][1]benzofuran-2-one |
| SMILES | O=C1C[C@H]2OCC[C@@]2(O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C8H10O4/c9-4-3-5-8(10,1-2-11-5)7-6(4)12-7/h5-7,10H,1-3H2/t5-,6-,7-,8+/m1/s1 |
| InChIKey | SOOZYIGRINXLFT-XUTVFYLZSA-N |
| XLogP | -0.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|