C22H20 — CID 101248325
1-[(E)-but-1-enyl]-4-[4-(4-ethylphenyl)buta-1,3-diynyl]benzene (PubChem CID 101248325) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-4-[4-(4-ethylphenyl)buta-1,3-diynyl]benzene.
| Compound Name | 1-[(E)-but-1-enyl]-4-[4-(4-ethylphenyl)buta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 101248325 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[(E)-but-1-enyl]-4-[4-(4-ethylphenyl)buta-1,3-diynyl]benzene |
| SMILES | CC/C=C/c1ccc(C#CC#Cc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C22H20/c1-3-5-8-20-15-17-22(18-16-20)10-7-6-9-21-13-11-19(4-2)12-14-21/h5,8,11-18H,3-4H2,1-2H3/b8-5+ |
| InChIKey | VAOZZPXNIYRJRG-VMPITWQZSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|