C23H40O8Si — CID 101250381
[(4aR,6S,8aR)-2,2-ditert-butyl-6-[[(2R,3S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate (PubChem CID 101250381) has the molecular formula C23H40O8Si and a molecular weight of 472.65 g/mol. Its IUPAC name is [(4aR,6S,8aR)-2,2-ditert-butyl-6-[[(2R,3S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate.
| Compound Name | [(4aR,6S,8aR)-2,2-ditert-butyl-6-[[(2R,3S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
|---|---|
| PubChem CID | 101250381 |
| Molecular Formula | C23H40O8Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(4aR,6S,8aR)-2,2-ditert-butyl-6-[[(2R,3S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] acetate |
| SMILES | CC(=O)OC1=C[C@H](CC2CCO[C@H](CO)[C@H]2O)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C23H40O8Si/c1-14(25)29-17-11-16(10-15-8-9-27-18(12-24)20(15)26)30-19-13-28-32(22(2,3)4,23(5,6)7)31-21(17)19/h11,15-16,18-21,24,26H,8-10,12-13H2,1-7H3/t15?,16-,18+,19+,20-,21-/m0/s1 |
| InChIKey | XIIZDUXWXJWXGR-NBQWFJEQSA-N |
| XLogP | 2.81 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|