C18H40O6P2S2 — CID 101252455
(1R)-1-deuterio-1-[[(1R)-1-deuterio-1-di(propan-2-yloxy)phosphorylpropyl]disulfanyl]-1-di(propan-2-yloxy)phosphorylpropane (PubChem CID 101252455) has the molecular formula C18H40O6P2S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (1R)-1-deuterio-1-[[(1R)-1-deuterio-1-di(propan-2-yloxy)phosphorylpropyl]disulfanyl]-1-di(propan-2-yloxy)phosphorylpropane.
| Compound Name | (1R)-1-deuterio-1-[[(1R)-1-deuterio-1-di(propan-2-yloxy)phosphorylpropyl]disulfanyl]-1-di(propan-2-yloxy)phosphorylpropane |
|---|---|
| PubChem CID | 101252455 |
| Molecular Formula | C18H40O6P2S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (1R)-1-deuterio-1-[[(1R)-1-deuterio-1-di(propan-2-yloxy)phosphorylpropyl]disulfanyl]-1-di(propan-2-yloxy)phosphorylpropane |
| SMILES | [2H][C@](CC)(SS[C@]([2H])(CC)P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H40O6P2S2/c1-11-17(25(19,21-13(3)4)22-14(5)6)27-28-18(12-2)26(20,23-15(7)8)24-16(9)10/h13-18H,11-12H2,1-10H3/t17-,18-/m1/s1/i17D,18D |
| InChIKey | VQQVDBBWSNKEEN-UAUYUMFTSA-N |
| XLogP | 7.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|