C18H40O6P2S4 — CID 10325067
2-[[[[di(propan-2-yloxy)phosphoryl-ethylsulfanylmethyl]disulfanyl]-ethylsulfanylmethyl]-propan-2-yloxyphosphoryl]oxypropane (PubChem CID 10325067) has the molecular formula C18H40O6P2S4 and a molecular weight of 542.73 g/mol. Its IUPAC name is 2-[[[[di(propan-2-yloxy)phosphoryl-ethylsulfanylmethyl]disulfanyl]-ethylsulfanylmethyl]-propan-2-yloxyphosphoryl]oxypropane.
| Compound Name | 2-[[[[di(propan-2-yloxy)phosphoryl-ethylsulfanylmethyl]disulfanyl]-ethylsulfanylmethyl]-propan-2-yloxyphosphoryl]oxypropane |
|---|---|
| PubChem CID | 10325067 |
| Molecular Formula | C18H40O6P2S4 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-[[[[di(propan-2-yloxy)phosphoryl-ethylsulfanylmethyl]disulfanyl]-ethylsulfanylmethyl]-propan-2-yloxyphosphoryl]oxypropane |
| SMILES | CCSC(SSC(SCC)P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H40O6P2S4/c1-11-27-17(25(19,21-13(3)4)22-14(5)6)29-30-18(28-12-2)26(20,23-15(7)8)24-16(9)10/h13-18H,11-12H2,1-10H3 |
| InChIKey | JUPTWEXSBALTQC-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|