C26H41NO9 — CID 101254092
(1R,15S,16R,18R,21R,23S)-23-methoxy-8-(3-methoxypropyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 101254092) has the molecular formula C26H41NO9 and a molecular weight of 511.61 g/mol. Its IUPAC name is (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(3-methoxypropyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(3-methoxypropyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 101254092 |
| Molecular Formula | C26H41NO9 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(3-methoxypropyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | COCCCN1CCOCCO[C@@H]2[C@@H](OCCOCC1)[C@@H](OC)O[C@@H]1CO[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C26H41NO9/c1-28-12-6-9-27-10-13-30-15-17-32-23-22-21(19-34-25(36-22)20-7-4-3-5-8-20)35-26(29-2)24(23)33-18-16-31-14-11-27/h3-5,7-8,21-26H,6,9-19H2,1-2H3/t21-,22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | DXQRWQKVMGHUAV-GOOFPYJASA-N |
| XLogP | 1.63 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|