C9H20O6SSi — CID 101254113
(E)-3-triethoxysilylprop-2-ene-1-sulfonic acid (PubChem CID 101254113) has the molecular formula C9H20O6SSi and a molecular weight of 284.41 g/mol. Its IUPAC name is (E)-3-triethoxysilylprop-2-ene-1-sulfonic acid.
| Compound Name | (E)-3-triethoxysilylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 101254113 |
| Molecular Formula | C9H20O6SSi |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (E)-3-triethoxysilylprop-2-ene-1-sulfonic acid |
| SMILES | CCO[Si](/C=C/CS(=O)(=O)O)(OCC)OCC |
| InChI | InChI=1S/C9H20O6SSi/c1-4-13-17(14-5-2,15-6-3)9-7-8-16(10,11)12/h7,9H,4-6,8H2,1-3H3,(H,10,11,12)/b9-7+ |
| InChIKey | FXRVEMKDHCVJMV-VQHVLOKHSA-N |
| XLogP | 1.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|