C16H24 — CID 101254578
[(E,4S)-4-methylnon-2-en-4-yl]benzene (PubChem CID 101254578) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is [(E,4S)-4-methylnon-2-en-4-yl]benzene.
| Compound Name | [(E,4S)-4-methylnon-2-en-4-yl]benzene |
|---|---|
| PubChem CID | 101254578 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | [(E,4S)-4-methylnon-2-en-4-yl]benzene |
| SMILES | C/C=C/[C@](C)(CCCCC)c1ccccc1 |
| InChI | InChI=1S/C16H24/c1-4-6-10-14-16(3,13-5-2)15-11-8-7-9-12-15/h5,7-9,11-13H,4,6,10,14H2,1-3H3/b13-5+/t16-/m1/s1 |
| InChIKey | DSNIGGJVQYZQLU-ZUFYJRLNSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|