C25H34 — CID 132510500
1-methyl-4-[(E,5R)-5-methyl-1-phenylundec-3-en-5-yl]benzene (PubChem CID 132510500) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-methyl-4-[(E,5R)-5-methyl-1-phenylundec-3-en-5-yl]benzene.
| Compound Name | 1-methyl-4-[(E,5R)-5-methyl-1-phenylundec-3-en-5-yl]benzene |
|---|---|
| PubChem CID | 132510500 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-methyl-4-[(E,5R)-5-methyl-1-phenylundec-3-en-5-yl]benzene |
| SMILES | CCCCCC[C@](C)(/C=C/CCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H34/c1-4-5-6-11-20-25(3,24-18-16-22(2)17-19-24)21-12-10-15-23-13-8-7-9-14-23/h7-9,12-14,16-19,21H,4-6,10-11,15,20H2,1-3H3/b21-12+/t25-/m1/s1 |
| InChIKey | CAQDOXXOVDGIPZ-XDAQDVOSSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|