C17H21ClN2O2 — CID 10125724
N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide;hydrochloride (PubChem CID 10125724) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide;hydrochloride.
| Compound Name | N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 10125724 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide;hydrochloride |
| SMILES | CCN(Cc1ccncc1)C(=O)C(CO)c1ccccc1.Cl |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15;/h3-11,16,20H,2,12-13H2,1H3;1H |
| InChIKey | JQIPVEBSCXNGIG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |