C23H23FN2O — CID 110296433
N-benzyl-N-ethyl-2-(4-fluorophenyl)-3-pyridin-3-ylpropanamide (PubChem CID 110296433) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-(4-fluorophenyl)-3-pyridin-3-ylpropanamide.
| Compound Name | N-benzyl-N-ethyl-2-(4-fluorophenyl)-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 110296433 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-benzyl-N-ethyl-2-(4-fluorophenyl)-3-pyridin-3-ylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(Cc1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O/c1-2-26(17-18-7-4-3-5-8-18)23(27)22(15-19-9-6-14-25-16-19)20-10-12-21(24)13-11-20/h3-14,16,22H,2,15,17H2,1H3 |
| InChIKey | CXXMAPISYSZOSK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |