C19H24O12 — CID 101257365
[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-[[(2S)-5-oxo-2H-pyran-2-yl]oxymethyl]oxan-3-yl] acetate (PubChem CID 101257365) has the molecular formula C19H24O12 and a molecular weight of 444.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-[[(2S)-5-oxo-2H-pyran-2-yl]oxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-[[(2S)-5-oxo-2H-pyran-2-yl]oxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101257365 |
| Molecular Formula | C19H24O12 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-[[(2S)-5-oxo-2H-pyran-2-yl]oxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](CO[C@@H]2C=CC(=O)CO2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24O12/c1-9(20)27-16-14(8-26-15-6-5-13(24)7-25-15)31-19(30-12(4)23)18(29-11(3)22)17(16)28-10(2)21/h5-6,14-19H,7-8H2,1-4H3/t14-,15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | OXEKXILUMVSWON-WVXCVLBUSA-N |
| XLogP | -0.43 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|