C23H31PS — CID 101260440
(1R,2S,5R)-1-(diphenylphosphanylmethyl)-5-methyl-2-propan-2-ylcyclohexane-1-thiol (PubChem CID 101260440) has the molecular formula C23H31PS and a molecular weight of 370.54 g/mol. Its IUPAC name is (1R,2S,5R)-1-(diphenylphosphanylmethyl)-5-methyl-2-propan-2-ylcyclohexane-1-thiol.
| Compound Name | (1R,2S,5R)-1-(diphenylphosphanylmethyl)-5-methyl-2-propan-2-ylcyclohexane-1-thiol |
|---|---|
| PubChem CID | 101260440 |
| Molecular Formula | C23H31PS |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1R,2S,5R)-1-(diphenylphosphanylmethyl)-5-methyl-2-propan-2-ylcyclohexane-1-thiol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@]1(S)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31PS/c1-18(2)22-15-14-19(3)16-23(22,25)17-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19,22,25H,14-17H2,1-3H3/t19-,22+,23+/m1/s1 |
| InChIKey | GDRDJVDOZVWVGP-OIBXWCBGSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|