C10H18O2 — CID 15728160
7-methyl-4-propan-2-yl-1,2-dioxaspiro[2.5]octane (PubChem CID 15728160) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 7-methyl-4-propan-2-yl-1,2-dioxaspiro[2.5]octane.
| Compound Name | 7-methyl-4-propan-2-yl-1,2-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 15728160 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 7-methyl-4-propan-2-yl-1,2-dioxaspiro[2.5]octane |
| SMILES | CC1CCC(C(C)C)C2(C1)OO2 |
| InChI | InChI=1S/C10H18O2/c1-7(2)9-5-4-8(3)6-10(9)11-12-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | GZGHLCLEBKZTGB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|