C7H15P — CID 101264634
(2S,6R)-2,6-dimethylphosphinane (PubChem CID 101264634) has the molecular formula C7H15P and a molecular weight of 130.17 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylphosphinane.
| Compound Name | (2S,6R)-2,6-dimethylphosphinane |
|---|---|
| PubChem CID | 101264634 |
| Molecular Formula | C7H15P |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | (2S,6R)-2,6-dimethylphosphinane |
| SMILES | C[C@@H]1CCC[C@H](C)P1 |
| InChI | InChI=1S/C7H15P/c1-6-4-3-5-7(2)8-6/h6-8H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | MLUPFTKEKZYUIP-KNVOCYPGSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|