C15H26O2Si — CID 101268556
(1S,8aR)-7-(2-hydroxyethyl)-4-trimethylsilyl-1,2,3,5,6,8a-hexahydroazulen-1-ol (PubChem CID 101268556) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (1S,8aR)-7-(2-hydroxyethyl)-4-trimethylsilyl-1,2,3,5,6,8a-hexahydroazulen-1-ol.
| Compound Name | (1S,8aR)-7-(2-hydroxyethyl)-4-trimethylsilyl-1,2,3,5,6,8a-hexahydroazulen-1-ol |
|---|---|
| PubChem CID | 101268556 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (1S,8aR)-7-(2-hydroxyethyl)-4-trimethylsilyl-1,2,3,5,6,8a-hexahydroazulen-1-ol |
| SMILES | C[Si](C)(C)C1=C2CC[C@H](O)[C@@H]2C=C(CCO)CC1 |
| InChI | InChI=1S/C15H26O2Si/c1-18(2,3)15-7-4-11(8-9-16)10-13-12(15)5-6-14(13)17/h10,13-14,16-17H,4-9H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | OXSYPWVQLAYNOP-KGLIPLIRSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|