C23H42O2Si — CID 134840191
(6R,8aS)-3,3,6-trimethyl-7-[tri(propan-2-yl)silyloxymethyl]-2,5,6,8a-tetrahydro-1H-azulen-1-ol (PubChem CID 134840191) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (6R,8aS)-3,3,6-trimethyl-7-[tri(propan-2-yl)silyloxymethyl]-2,5,6,8a-tetrahydro-1H-azulen-1-ol.
| Compound Name | (6R,8aS)-3,3,6-trimethyl-7-[tri(propan-2-yl)silyloxymethyl]-2,5,6,8a-tetrahydro-1H-azulen-1-ol |
|---|---|
| PubChem CID | 134840191 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (6R,8aS)-3,3,6-trimethyl-7-[tri(propan-2-yl)silyloxymethyl]-2,5,6,8a-tetrahydro-1H-azulen-1-ol |
| SMILES | CC(C)[Si](OCC1=C[C@H]2C(=CC[C@H]1C)C(C)(C)CC2O)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-15(2)26(16(3)4,17(5)6)25-14-19-12-20-21(11-10-18(19)7)23(8,9)13-22(20)24/h11-12,15-18,20,22,24H,10,13-14H2,1-9H3/t18-,20+,22?/m1/s1 |
| InChIKey | DORBZRGOOICCNG-XAFCGNCNSA-N |
| XLogP | 6.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|