C21H42O2Si — CID 71619638
(E,3S)-1-[(1R,2S)-2-tri(propan-2-yl)silyloxycyclopentyl]hept-1-en-3-ol (PubChem CID 71619638) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is (E,3S)-1-[(1R,2S)-2-tri(propan-2-yl)silyloxycyclopentyl]hept-1-en-3-ol.
| Compound Name | (E,3S)-1-[(1R,2S)-2-tri(propan-2-yl)silyloxycyclopentyl]hept-1-en-3-ol |
|---|---|
| PubChem CID | 71619638 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (E,3S)-1-[(1R,2S)-2-tri(propan-2-yl)silyloxycyclopentyl]hept-1-en-3-ol |
| SMILES | CCCC[C@H](O)/C=C/[C@H]1CCC[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-8-9-12-20(22)15-14-19-11-10-13-21(19)23-24(16(2)3,17(4)5)18(6)7/h14-22H,8-13H2,1-7H3/b15-14+/t19-,20+,21+/m1/s1 |
| InChIKey | AVUFYRMMDMCWQL-MBTLSUMZSA-N |
| XLogP | 6.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|