C14H22O2 — CID 23643476
(1R,6R,8aS)-7-(hydroxymethyl)-3,3,6-trimethyl-2,5,6,8a-tetrahydro-1H-azulen-1-ol (PubChem CID 23643476) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,6R,8aS)-7-(hydroxymethyl)-3,3,6-trimethyl-2,5,6,8a-tetrahydro-1H-azulen-1-ol.
| Compound Name | (1R,6R,8aS)-7-(hydroxymethyl)-3,3,6-trimethyl-2,5,6,8a-tetrahydro-1H-azulen-1-ol |
|---|---|
| PubChem CID | 23643476 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,6R,8aS)-7-(hydroxymethyl)-3,3,6-trimethyl-2,5,6,8a-tetrahydro-1H-azulen-1-ol |
| SMILES | C[C@@H]1CC=C2[C@H](C=C1CO)[C@H](O)CC2(C)C |
| InChI | InChI=1S/C14H22O2/c1-9-4-5-12-11(6-10(9)8-15)13(16)7-14(12,2)3/h5-6,9,11,13,15-16H,4,7-8H2,1-3H3/t9-,11+,13-/m1/s1 |
| InChIKey | BRSRAEUIPADDOU-SUZMYJTESA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|