C28H32N2O9 — CID 101268976
4-acetamido-2-[10-(5-acetamido-2-carboxyphenoxy)-10-oxodecanoyl]benzoic acid (PubChem CID 101268976) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is 4-acetamido-2-[10-(5-acetamido-2-carboxyphenoxy)-10-oxodecanoyl]benzoic acid.
| Compound Name | 4-acetamido-2-[10-(5-acetamido-2-carboxyphenoxy)-10-oxodecanoyl]benzoic acid |
|---|---|
| PubChem CID | 101268976 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 4-acetamido-2-[10-(5-acetamido-2-carboxyphenoxy)-10-oxodecanoyl]benzoic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)O)c(OC(=O)CCCCCCCCC(=O)c2cc(NC(C)=O)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C28H32N2O9/c1-17(31)29-19-11-13-21(27(35)36)23(15-19)24(33)9-7-5-3-4-6-8-10-26(34)39-25-16-20(30-18(2)32)12-14-22(25)28(37)38/h11-16H,3-10H2,1-2H3,(H,29,31)(H,30,32)(H,35,36)(H,37,38) |
| InChIKey | CBALXWKSXLOPHQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|