C17H29IN4O5S — CID 101269288
N-[2-[3-(3-iodopropanoylamino)propoxy]ethyl]-3-[(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)methoxy]propanamide (PubChem CID 101269288) has the molecular formula C17H29IN4O5S and a molecular weight of 528.41 g/mol. Its IUPAC name is N-[2-[3-(3-iodopropanoylamino)propoxy]ethyl]-3-[(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)methoxy]propanamide.
| Compound Name | N-[2-[3-(3-iodopropanoylamino)propoxy]ethyl]-3-[(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)methoxy]propanamide |
|---|---|
| PubChem CID | 101269288 |
| Molecular Formula | C17H29IN4O5S |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | N-[2-[3-(3-iodopropanoylamino)propoxy]ethyl]-3-[(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)methoxy]propanamide |
| SMILES | O=C(CCI)NCCCOCCNC(=O)CCOCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C17H29IN4O5S/c18-4-2-14(23)19-5-1-7-26-9-6-20-15(24)3-8-27-10-13-16-12(11-28-13)21-17(25)22-16/h12-13,16H,1-11H2,(H,19,23)(H,20,24)(H2,21,22,25) |
| InChIKey | JEJUGAKJKYCLLK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|