C18H30N4O5S — CID 153412688
N-(4-methyl-3-oxopentyl)-3-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]propanamide (PubChem CID 153412688) has the molecular formula C18H30N4O5S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(4-methyl-3-oxopentyl)-3-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]propanamide.
| Compound Name | N-(4-methyl-3-oxopentyl)-3-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]propanamide |
|---|---|
| PubChem CID | 153412688 |
| Molecular Formula | C18H30N4O5S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-(4-methyl-3-oxopentyl)-3-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]propanamide |
| SMILES | CC(C)C(=O)CCNC(=O)CCOCCNC(=O)CC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C18H30N4O5S/c1-11(2)13(23)3-5-19-15(24)4-7-27-8-6-20-16(25)9-14-17-12(10-28-14)21-18(26)22-17/h11-12,14,17H,3-10H2,1-2H3,(H,19,24)(H,20,25)(H2,21,22,26) |
| InChIKey | NLRIAGKHCUJJPE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|