C15H28N3O7PS — CID 140902733
tert-butyl 2-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]ethyl hydrogen phosphate (PubChem CID 140902733) has the molecular formula C15H28N3O7PS and a molecular weight of 425.44 g/mol. Its IUPAC name is tert-butyl 2-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]ethyl hydrogen phosphate.
| Compound Name | tert-butyl 2-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 140902733 |
| Molecular Formula | C15H28N3O7PS |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | tert-butyl 2-[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]ethoxy]ethyl hydrogen phosphate |
| SMILES | CC(C)(C)OP(=O)(O)OCCOCCNC(=O)CC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C15H28N3O7PS/c1-15(2,3)25-26(21,22)24-7-6-23-5-4-16-12(19)8-11-13-10(9-27-11)17-14(20)18-13/h10-11,13H,4-9H2,1-3H3,(H,16,19)(H,21,22)(H2,17,18,20) |
| InChIKey | UPPYLJGQJXXSED-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|