C23H44N3O8PS — CID 157277226
tert-butyl 2-ethoxyethyl [3-methoxy-5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]pentyl] phosphate (PubChem CID 157277226) has the molecular formula C23H44N3O8PS and a molecular weight of 553.66 g/mol. Its IUPAC name is tert-butyl 2-ethoxyethyl [3-methoxy-5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]pentyl] phosphate.
| Compound Name | tert-butyl 2-ethoxyethyl [3-methoxy-5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]pentyl] phosphate |
|---|---|
| PubChem CID | 157277226 |
| Molecular Formula | C23H44N3O8PS |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | tert-butyl 2-ethoxyethyl [3-methoxy-5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanoylamino]pentyl] phosphate |
| SMILES | CCOCCOP(=O)(OCCC(CCNC(=O)CCCC1SCC2NC(=O)NC21)OC)OC(C)(C)C |
| InChI | InChI=1S/C23H44N3O8PS/c1-6-31-14-15-33-35(29,34-23(2,3)4)32-13-11-17(30-5)10-12-24-20(27)9-7-8-19-21-18(16-36-19)25-22(28)26-21/h17-19,21H,6-16H2,1-5H3,(H,24,27)(H2,25,26,28) |
| InChIKey | FHEWKKKYQXCJNB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|