C23H45N4O6PS2 — CID 159077786
N-[5-[[2-ethoxyethoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]amino]-3-methoxypentyl]-4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanamide (PubChem CID 159077786) has the molecular formula C23H45N4O6PS2 and a molecular weight of 568.74 g/mol. Its IUPAC name is N-[5-[[2-ethoxyethoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]amino]-3-methoxypentyl]-4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanamide.
| Compound Name | N-[5-[[2-ethoxyethoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]amino]-3-methoxypentyl]-4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanamide |
|---|---|
| PubChem CID | 159077786 |
| Molecular Formula | C23H45N4O6PS2 |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | N-[5-[[2-ethoxyethoxy-[(2-methylpropan-2-yl)oxy]phosphinothioyl]amino]-3-methoxypentyl]-4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butanamide |
| SMILES | CCOCCOP(=S)(NCCC(CCNC(=O)CCCC1SCC2NC(=O)NC21)OC)OC(C)(C)C |
| InChI | InChI=1S/C23H45N4O6PS2/c1-6-31-14-15-32-34(35,33-23(2,3)4)25-13-11-17(30-5)10-12-24-20(28)9-7-8-19-21-18(16-36-19)26-22(29)27-21/h17-19,21H,6-16H2,1-5H3,(H,24,28)(H,25,35)(H2,26,27,29) |
| InChIKey | HPVPQRDYXJAZRS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|