C25H40O2 — CID 101269518
(E)-5-[(1S,2R,4aS,8aS)-2,5,8a-trimethyl-2-(4-methylpent-3-enyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoic acid (PubChem CID 101269518) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (E)-5-[(1S,2R,4aS,8aS)-2,5,8a-trimethyl-2-(4-methylpent-3-enyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoic acid.
| Compound Name | (E)-5-[(1S,2R,4aS,8aS)-2,5,8a-trimethyl-2-(4-methylpent-3-enyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 101269518 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (E)-5-[(1S,2R,4aS,8aS)-2,5,8a-trimethyl-2-(4-methylpent-3-enyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enoic acid |
| SMILES | CC(C)=CCC[C@]1(C)CC[C@H]2C(C)=CCC[C@@]2(C)[C@H]1CC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C25H40O2/c1-18(2)9-7-14-24(5)16-13-21-20(4)10-8-15-25(21,6)22(24)12-11-19(3)17-23(26)27/h9-10,17,21-22H,7-8,11-16H2,1-6H3,(H,26,27)/b19-17+/t21-,22-,24+,25+/m0/s1 |
| InChIKey | OQQNJVBLPBUXTO-SVZABIGPSA-N |
| XLogP | 7.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|