C19H20Cl2O2 — CID 101269867
(1R,4S)-1,4-bis(4-chlorophenyl)hept-6-ene-1,4-diol (PubChem CID 101269867) has the molecular formula C19H20Cl2O2 and a molecular weight of 351.27 g/mol. Its IUPAC name is (1R,4S)-1,4-bis(4-chlorophenyl)hept-6-ene-1,4-diol.
| Compound Name | (1R,4S)-1,4-bis(4-chlorophenyl)hept-6-ene-1,4-diol |
|---|---|
| PubChem CID | 101269867 |
| Molecular Formula | C19H20Cl2O2 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (1R,4S)-1,4-bis(4-chlorophenyl)hept-6-ene-1,4-diol |
| SMILES | C=CC[C@@](O)(CC[C@@H](O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2O2/c1-2-12-19(23,15-5-9-17(21)10-6-15)13-11-18(22)14-3-7-16(20)8-4-14/h2-10,18,22-23H,1,11-13H2/t18-,19-/m1/s1 |
| InChIKey | MNGUOAGYJLHPHC-RTBURBONSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|