C20H22Cl2O2 — CID 11485346
(1R,4S,5S)-1,4-bis(4-chlorophenyl)-5-methylhept-6-ene-1,4-diol (PubChem CID 11485346) has the molecular formula C20H22Cl2O2 and a molecular weight of 365.30 g/mol. Its IUPAC name is (1R,4S,5S)-1,4-bis(4-chlorophenyl)-5-methylhept-6-ene-1,4-diol.
| Compound Name | (1R,4S,5S)-1,4-bis(4-chlorophenyl)-5-methylhept-6-ene-1,4-diol |
|---|---|
| PubChem CID | 11485346 |
| Molecular Formula | C20H22Cl2O2 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (1R,4S,5S)-1,4-bis(4-chlorophenyl)-5-methylhept-6-ene-1,4-diol |
| SMILES | C=C[C@H](C)[C@@](O)(CC[C@@H](O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2O2/c1-3-14(2)20(24,16-6-10-18(22)11-7-16)13-12-19(23)15-4-8-17(21)9-5-15/h3-11,14,19,23-24H,1,12-13H2,2H3/t14-,19+,20-/m0/s1 |
| InChIKey | AYYBNNKBFFOUAL-KPOBHBOGSA-N |
| XLogP | 5.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|