C16H25ClO — CID 155261588
3-(4-chlorophenyl)-2,6,6-trimethylheptan-3-ol (PubChem CID 155261588) has the molecular formula C16H25ClO and a molecular weight of 268.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,6,6-trimethylheptan-3-ol.
| Compound Name | 3-(4-chlorophenyl)-2,6,6-trimethylheptan-3-ol |
|---|---|
| PubChem CID | 155261588 |
| Molecular Formula | C16H25ClO |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-(4-chlorophenyl)-2,6,6-trimethylheptan-3-ol |
| SMILES | CC(C)C(O)(CCC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClO/c1-12(2)16(18,11-10-15(3,4)5)13-6-8-14(17)9-7-13/h6-9,12,18H,10-11H2,1-5H3 |
| InChIKey | HELZNXVLNBKFKD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |