C14H19ClO — CID 90940577
4-(4-chlorophenyl)-4,5-dimethylhexanal (PubChem CID 90940577) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4,5-dimethylhexanal.
| Compound Name | 4-(4-chlorophenyl)-4,5-dimethylhexanal |
|---|---|
| PubChem CID | 90940577 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-(4-chlorophenyl)-4,5-dimethylhexanal |
| SMILES | CC(C)C(C)(CCC=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClO/c1-11(2)14(3,9-4-10-16)12-5-7-13(15)8-6-12/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | YXSIXMNWPOZVMF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|