C18H30ClN — CID 142076103
5-(4-chlorophenyl)-N,N,2,5-tetramethyloctan-4-amine (PubChem CID 142076103) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,N,2,5-tetramethyloctan-4-amine.
| Compound Name | 5-(4-chlorophenyl)-N,N,2,5-tetramethyloctan-4-amine |
|---|---|
| PubChem CID | 142076103 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 5-(4-chlorophenyl)-N,N,2,5-tetramethyloctan-4-amine |
| SMILES | CCCC(C)(c1ccc(Cl)cc1)C(CC(C)C)N(C)C |
| InChI | InChI=1S/C18H30ClN/c1-7-12-18(4,15-8-10-16(19)11-9-15)17(20(5)6)13-14(2)3/h8-11,14,17H,7,12-13H2,1-6H3 |
| InChIKey | FABGLXORCWJBTM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |