About 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine
2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine (PubChem CID 43830762) has the molecular formula C15H25ClN2
and a molecular weight of 268.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine |
| PubChem CID | 43830762 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine |
| SMILES | CCC(N(CC)CC)C(C)(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H25ClN2/c1-5-14(18(6-2)7-3)15(4,17)12-8-10-13(16)11-9-12/h8-11,14H,5-7,17H2,1-4H3 |
| InChIKey | CYVZXNOCIHCAHT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine?
The IUPAC name of 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine (CID 43830762) is 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine.
What is the SMILES notation for 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine?
The canonical SMILES for 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine is CCC(N(CC)CC)C(C)(N)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine?
The InChIKey is CYVZXNOCIHCAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25ClN2/c1-5-14(18(6-2)7-3)15(4,17)12-8-10-13(16)11-9-12/h8-11,14H,5-7,17H2,1-4H3.
What are the key properties of 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine?
2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine has a molecular weight of 268.83 g/mol, XLogP of 3.63, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3-N,3-N-diethylpentane-2,3-diamine is sourced from PubChem (CID 43830762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).