C19H34N2 — CID 43829679
2-phenyl-3-N,3-N-dipropylheptane-2,3-diamine (PubChem CID 43829679) has the molecular formula C19H34N2 and a molecular weight of 290.49 g/mol. Its IUPAC name is 2-phenyl-3-N,3-N-dipropylheptane-2,3-diamine.
| Compound Name | 2-phenyl-3-N,3-N-dipropylheptane-2,3-diamine |
|---|---|
| PubChem CID | 43829679 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 2-phenyl-3-N,3-N-dipropylheptane-2,3-diamine |
| SMILES | CCCCC(N(CCC)CCC)C(C)(N)c1ccccc1 |
| InChI | InChI=1S/C19H34N2/c1-5-8-14-18(21(15-6-2)16-7-3)19(4,20)17-12-10-9-11-13-17/h9-13,18H,5-8,14-16,20H2,1-4H3 |
| InChIKey | DXZJQBHNRRVUTH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |