C17H29FN2 — CID 43830567
2-(2-fluorophenyl)-3-N,3-N-dipropylpentane-2,3-diamine (PubChem CID 43830567) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-N,3-N-dipropylpentane-2,3-diamine.
| Compound Name | 2-(2-fluorophenyl)-3-N,3-N-dipropylpentane-2,3-diamine |
|---|---|
| PubChem CID | 43830567 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-(2-fluorophenyl)-3-N,3-N-dipropylpentane-2,3-diamine |
| SMILES | CCCN(CCC)C(CC)C(C)(N)c1ccccc1F |
| InChI | InChI=1S/C17H29FN2/c1-5-12-20(13-6-2)16(7-3)17(4,19)14-10-8-9-11-15(14)18/h8-11,16H,5-7,12-13,19H2,1-4H3 |
| InChIKey | KDCJOBIRABMUMB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |