C18H29FN2 — CID 43830600
3-N,3-N-diethyl-4-(2-fluorophenyl)-6-methylhept-6-ene-3,4-diamine (PubChem CID 43830600) has the molecular formula C18H29FN2 and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-N,3-N-diethyl-4-(2-fluorophenyl)-6-methylhept-6-ene-3,4-diamine.
| Compound Name | 3-N,3-N-diethyl-4-(2-fluorophenyl)-6-methylhept-6-ene-3,4-diamine |
|---|---|
| PubChem CID | 43830600 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-N,3-N-diethyl-4-(2-fluorophenyl)-6-methylhept-6-ene-3,4-diamine |
| SMILES | C=C(C)CC(N)(c1ccccc1F)C(CC)N(CC)CC |
| InChI | InChI=1S/C18H29FN2/c1-6-17(21(7-2)8-3)18(20,13-14(4)5)15-11-9-10-12-16(15)19/h9-12,17H,4,6-8,13,20H2,1-3,5H3 |
| InChIKey | IKIZSAAQGQJRIK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|