C16H27FN2 — CID 43830618
3-(2-fluorophenyl)-4-N,4-N,2-trimethylheptane-3,4-diamine (PubChem CID 43830618) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4-N,4-N,2-trimethylheptane-3,4-diamine.
| Compound Name | 3-(2-fluorophenyl)-4-N,4-N,2-trimethylheptane-3,4-diamine |
|---|---|
| PubChem CID | 43830618 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3-(2-fluorophenyl)-4-N,4-N,2-trimethylheptane-3,4-diamine |
| SMILES | CCCC(N(C)C)C(N)(c1ccccc1F)C(C)C |
| InChI | InChI=1S/C16H27FN2/c1-6-9-15(19(4)5)16(18,12(2)3)13-10-7-8-11-14(13)17/h7-8,10-12,15H,6,9,18H2,1-5H3 |
| InChIKey | NVHDMRSHNHLBIZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |