C23H29FN2 — CID 19384647
3-[benzyl(methyl)amino]-2-(2-fluorophenyl)-2-propan-2-ylhexanenitrile (PubChem CID 19384647) has the molecular formula C23H29FN2 and a molecular weight of 352.50 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-2-(2-fluorophenyl)-2-propan-2-ylhexanenitrile.
| Compound Name | 3-[benzyl(methyl)amino]-2-(2-fluorophenyl)-2-propan-2-ylhexanenitrile |
|---|---|
| PubChem CID | 19384647 |
| Molecular Formula | C23H29FN2 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 3-[benzyl(methyl)amino]-2-(2-fluorophenyl)-2-propan-2-ylhexanenitrile |
| SMILES | CCCC(N(C)Cc1ccccc1)C(C#N)(c1ccccc1F)C(C)C |
| InChI | InChI=1S/C23H29FN2/c1-5-11-22(26(4)16-19-12-7-6-8-13-19)23(17-25,18(2)3)20-14-9-10-15-21(20)24/h6-10,12-15,18,22H,5,11,16H2,1-4H3 |
| InChIKey | JLPMLAFDRDXCEV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |