C20H30N2 — CID 43829611
6-methyl-4-phenyl-3-N,3-N-bis(prop-2-enyl)hept-6-ene-3,4-diamine (PubChem CID 43829611) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-methyl-4-phenyl-3-N,3-N-bis(prop-2-enyl)hept-6-ene-3,4-diamine.
| Compound Name | 6-methyl-4-phenyl-3-N,3-N-bis(prop-2-enyl)hept-6-ene-3,4-diamine |
|---|---|
| PubChem CID | 43829611 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 6-methyl-4-phenyl-3-N,3-N-bis(prop-2-enyl)hept-6-ene-3,4-diamine |
| SMILES | C=CCN(CC=C)C(CC)C(N)(CC(=C)C)c1ccccc1 |
| InChI | InChI=1S/C20H30N2/c1-6-14-22(15-7-2)19(8-3)20(21,16-17(4)5)18-12-10-9-11-13-18/h6-7,9-13,19H,1-2,4,8,14-16,21H2,3,5H3 |
| InChIKey | HFAKMWOKAALYHD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|