C18H30N2 — CID 43829791
4-methyl-2-phenyl-1-N,1-N-dipropylpent-4-ene-1,2-diamine (PubChem CID 43829791) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1-N,1-N-dipropylpent-4-ene-1,2-diamine.
| Compound Name | 4-methyl-2-phenyl-1-N,1-N-dipropylpent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 43829791 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 4-methyl-2-phenyl-1-N,1-N-dipropylpent-4-ene-1,2-diamine |
| SMILES | C=C(C)CC(N)(CN(CCC)CCC)c1ccccc1 |
| InChI | InChI=1S/C18H30N2/c1-5-12-20(13-6-2)15-18(19,14-16(3)4)17-10-8-7-9-11-17/h7-11H,3,5-6,12-15,19H2,1-2,4H3 |
| InChIKey | GPUFBGWOOZEEAY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|