C15H23F3N2O — CID 116695800
1-amino-2-phenyl-4-[propyl(2,2,2-trifluoroethyl)amino]butan-2-ol (PubChem CID 116695800) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-amino-2-phenyl-4-[propyl(2,2,2-trifluoroethyl)amino]butan-2-ol.
| Compound Name | 1-amino-2-phenyl-4-[propyl(2,2,2-trifluoroethyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 116695800 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-amino-2-phenyl-4-[propyl(2,2,2-trifluoroethyl)amino]butan-2-ol |
| SMILES | CCCN(CCC(O)(CN)c1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O/c1-2-9-20(12-15(16,17)18)10-8-14(21,11-19)13-6-4-3-5-7-13/h3-7,21H,2,8-12,19H2,1H3 |
| InChIKey | WEWLNMRFOAOBTO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |