C14H21F3N2O — CID 116695191
2-amino-4-[ethyl(2,2,2-trifluoroethyl)amino]-2-phenylbutan-1-ol (PubChem CID 116695191) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-amino-4-[ethyl(2,2,2-trifluoroethyl)amino]-2-phenylbutan-1-ol.
| Compound Name | 2-amino-4-[ethyl(2,2,2-trifluoroethyl)amino]-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 116695191 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-amino-4-[ethyl(2,2,2-trifluoroethyl)amino]-2-phenylbutan-1-ol |
| SMILES | CCN(CCC(N)(CO)c1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O/c1-2-19(10-14(15,16)17)9-8-13(18,11-20)12-6-4-3-5-7-12/h3-7,20H,2,8-11,18H2,1H3 |
| InChIKey | FRTFVBYEBVUJND-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |