C13H19F2NO — CID 116790403
3-[(2,2-difluoro-2-phenylethyl)-ethylamino]propan-1-ol (PubChem CID 116790403) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-[(2,2-difluoro-2-phenylethyl)-ethylamino]propan-1-ol.
| Compound Name | 3-[(2,2-difluoro-2-phenylethyl)-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 116790403 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-[(2,2-difluoro-2-phenylethyl)-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C13H19F2NO/c1-2-16(9-6-10-17)11-13(14,15)12-7-4-3-5-8-12/h3-5,7-8,17H,2,6,9-11H2,1H3 |
| InChIKey | HTELNKIRIAXYJG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |