C12H16BrF2N — CID 116790603
1-bromo-N-(2,2-difluoro-2-phenylethyl)-N-methylpropan-2-amine (PubChem CID 116790603) has the molecular formula C12H16BrF2N and a molecular weight of 292.17 g/mol. Its IUPAC name is 1-bromo-N-(2,2-difluoro-2-phenylethyl)-N-methylpropan-2-amine.
| Compound Name | 1-bromo-N-(2,2-difluoro-2-phenylethyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 116790603 |
| Molecular Formula | C12H16BrF2N |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 1-bromo-N-(2,2-difluoro-2-phenylethyl)-N-methylpropan-2-amine |
| SMILES | CC(CBr)N(C)CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C12H16BrF2N/c1-10(8-13)16(2)9-12(14,15)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | TWSPFXGJHKEGSO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|