C11H14F2N2S — CID 116789418
2-[(2,2-difluoro-2-phenylethyl)-methylamino]ethanethioamide (PubChem CID 116789418) has the molecular formula C11H14F2N2S and a molecular weight of 244.31 g/mol. Its IUPAC name is 2-[(2,2-difluoro-2-phenylethyl)-methylamino]ethanethioamide.
| Compound Name | 2-[(2,2-difluoro-2-phenylethyl)-methylamino]ethanethioamide |
|---|---|
| PubChem CID | 116789418 |
| Molecular Formula | C11H14F2N2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[(2,2-difluoro-2-phenylethyl)-methylamino]ethanethioamide |
| SMILES | CN(CC(N)=S)CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C11H14F2N2S/c1-15(7-10(14)16)8-11(12,13)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,14,16) |
| InChIKey | DURGGYVINDNGEY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|