C15H23F2N3O — CID 116789548
3-[(2,2-difluoro-2-phenylethyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 116789548) has the molecular formula C15H23F2N3O and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-[(2,2-difluoro-2-phenylethyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(2,2-difluoro-2-phenylethyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 116789548 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-[(2,2-difluoro-2-phenylethyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)CN(CC/C(N)=N/O)CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C15H23F2N3O/c1-12(2)10-20(9-8-14(18)19-21)11-15(16,17)13-6-4-3-5-7-13/h3-7,12,21H,8-11H2,1-2H3,(H2,18,19) |
| InChIKey | XJJIUZSTDSNULE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|