C13H18ClF2N — CID 116790609
1-chloro-N-(2,2-difluoro-2-phenylethyl)-N,2-dimethylpropan-2-amine (PubChem CID 116790609) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is 1-chloro-N-(2,2-difluoro-2-phenylethyl)-N,2-dimethylpropan-2-amine.
| Compound Name | 1-chloro-N-(2,2-difluoro-2-phenylethyl)-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 116790609 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-chloro-N-(2,2-difluoro-2-phenylethyl)-N,2-dimethylpropan-2-amine |
| SMILES | CN(CC(F)(F)c1ccccc1)C(C)(C)CCl |
| InChI | InChI=1S/C13H18ClF2N/c1-12(2,9-14)17(3)10-13(15,16)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | KWTKSVNBJCWMKE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|